| Identification | |
| Name: | 2,4-Dichloro-5-fluoroacetophenone |
| Synonyms: | 1-(2,4-dichloro-5-fluorophenyl)ethan-1-one |
| CAS: | 704-10-9 |
| EINECS: | C8H5Cl2FO |
| Molecular Formula: | C8H5Cl2FO |
| Molecular Weight: | 207.029103 |
| InChI: | InChI=1S/C8H5Cl2FO/c1-4(12)5-2-8(11)7(10)3-6(5)9/h2-3H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 50kgs |
| Density: | 1.425 |
| Refractive index: | 1.546 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | White to pale-yellow Crystal |
| Specification: | white to light yellow cryst. low melting solid Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
