| Identification | |
| Name: | 5-Fluoro-2-nitrotoluene |
| Synonyms: | Fluoronitrotoluene5; 2-Nitro-5-Fluoro Toluene; 4-Fluoro-2-methyl-1-nitrobenzene |
| CAS: | 446-33-3 |
| EINECS: | 207-164-4 |
| Molecular Formula: | C7H6FNO2 |
| Molecular Weight: | 155.13 |
| InChI: | InChI=1/C7H6FNO2/c1-5-4-6(8)2-3-7(5)9(10)11/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.272 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.526-1.528 |
| Solubility: | Insoluble |
| Specification: | colorless to light yellow liqui Safety Statements:26-36-45-37-28A 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 37:Wear suitable gloves |
| Packinggroup: | III |
| HS Code: | 29049085 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
