| Identification |
| Name: | 2-Fluoro-6-nitrotoluene |
| Synonyms: | 1-Fluor-2-methyl-3-nitrobenzene |
| CAS: | 769-10-8 |
| EINECS: | 212-203-3 |
| Molecular Formula: | C7H6FNO2 |
| Molecular Weight: | 155.13 |
| InChI: | InChI=1/C7H6FNO2/c1-5-6(8)3-2-4-7(5)9(10)11/h2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2810 |
| Density: | 1.27 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.522-1.524 |
| Solubility: | Insoluble |
| Appearance: | colorless to light yellow liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
