| Identification |
| Name: | N,N-Dimethylformamide-d7 |
| Synonyms: | Dimethylformamidedisotopicpurity |
| CAS: | 4472-41-7 |
| EINECS: | 224-745-8 |
| Molecular Formula: | [2H]7C3NO |
| Molecular Weight: | 80.13 |
| InChI: | InChI=1/C3H7NO/c1-4(2)3-5/h3H,1-2H3/i1D3,2D3,3D |
| Molecular Structure: |
![([2H]7C3NO) Dimethylformamidedisotopicpurity](https://img.guidechem.com/casimg/4472-41-7.gif) |
| Properties |
| Transport: | UN 2265 3 |
| Density: | 1.03 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Protect from moisture. |
| Refractive index: | n20/D 1.428(lit.) |
| Water Solubility: | Soluble in water, ethanol and ether |
| Solubility: | Soluble in water, ethanol and ether |
| Appearance: | clear, colorless liquid |
| Packinggroup: | III |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
