| Identification |
| Name: | formic acid, compound with N,N-dimethylformamide (1:1) |
| Synonyms: | Formic acid, compd. with N,N-dimethylformamide (1:1);Formic acid, N,N-dimethylformamide salt;Formic acid, compound with N,N-dimethylformamide (1:1);formic acid - N,N-dimethylformamide (1:1) |
| CAS: | 68258-70-8 |
| EINECS: | 269-492-4 |
| Molecular Formula: | C4H9NO3 |
| Molecular Weight: | 119.1192 |
| InChI: | InChI=1/C3H7NO.CH2O2/c1-4(2)3-5;2-1-3/h3H,1-2H3;1H,(H,2,3) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 57.8°C |
| Boiling Point: | 153°C at 760 mmHg |
| Flash Point: | 57.8°C |
| Safety Data |
| |
 |