| Identification | |
| Name: | 2(1H)-Pyridinone,4-nitro- |
| Synonyms: | 2-Pyridinol,4-nitro- (7CI,8CI);4-Nitropyrid-2-one; |
| CAS: | 4487-51-8 |
| Molecular Formula: | C5H4N2O3 |
| Molecular Weight: | 140.1 |
| InChI: | InChI=1/C5H4N2O3/c8-5-3-4(7(9)10)1-2-6-5/h1-3H,(H,6,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.44 |
| Refractive index: | 1.588 |
| Specification: |
The 2-Hydroxy-4-nitropyridine with cas registry number of 4487-51-8 belongs to the categories of nitro; pyridines. Its IUPAC name is called 4-nitro-1H-pyridin-2-one. This chemical is also known as 2(1H)-Pyridinone,4-nitro-(9CI); 4-nitropyridin-2(1H)-one. Physical properties about this chemical are: (1)ACD/LogP: -1.07; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.07; (4)ACD/LogD (pH 7.4): -1.07; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 6.25; (8)ACD/KOC (pH 7.4): 6.25; (9)#H bond acceptors: 5; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 1; (12)Index of Refraction: 1.588; (13)Molar Refractivity: 32.54 cm3; (14)Molar Volume: 96.7 cm3 ; (15)Surface Tension: 55.8 dyne/cm; (16)Density: 1.44 g/cm3; (17)Flash Point: 155.8 °C; (18)Enthalpy of Vaporization: 57.7 kJ/mol; (19)Boiling Point: 334 °C at 760 mmHg; (20)Vapour Pressure: 0.000131 mmHg at 25°C. In addition, you could convert the following data information into the molecular structure: |
| Safety Data | |
 |
|
