| Identification | |
| Name: | Benzene,1-bromo-4-fluoro-2-methoxy- |
| Synonyms: | 1-Bromo-4-fluoro-2-methoxybenzene;2-Bromo-5-fluoroanisole;Anisole,6-bromo-3-fluoro- (8CI); |
| CAS: | 450-88-4 |
| Molecular Formula: | C7H6BrFO |
| Molecular Weight: | 205.02 |
| InChI: | InChI=1/C7H6BrFO/c1-10-7-4-5(9)2-3-6(7)8/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 90 ºC |
| Boiling Point: | 143-145 ºC |
| Density: | 1.5983 |
| Refractive index: | 1.542 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 90 ºC |
| Storage Temperature: | Room temperature. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
