| Identification | |
| Name: | 4-Fluoro-2-methylaniline |
| Synonyms: | 2-Amino-5-fluorotoluene; 4-Fluoro-2-methylbenzeneamine; 4-Fluoro-o-toluidine |
| CAS: | 452-71-1 |
| EINECS: | 207-208-2 |
| Molecular Formula: | C7H8FN |
| Molecular Weight: | 125.14 |
| InChI: | InChI=1/C7H8FN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Melting Point: | 14 |
| Density: | 1.126 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.535-1.538 |
| Solubility: | Slightly soluble |
| Appearance: | colorless to light yellow liquid |
| Specification: | colorlesstolightyellowliqui Safety Statements:26-36/37/39-45-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
