| Identification |
| Name: | 5-Fluoro-2-methylaniline |
| Synonyms: | 5-Fluoro-o-toluidine; Fluoromethylaniline7; 2-Amino-4-fluorotoluene~5-Fluoro-o-toluidine; 4-Fluoro-2-Aminotoluene; 2-Amino-4-Fluoro Toluene |
| CAS: | 367-29-3 |
| EINECS: | 206-689-6 |
| Molecular Formula: | C7H8FN |
| Molecular Weight: | 125.14 |
| InChI: | InChI=1/C7H8FN/c1-5-2-3-6(8)4-7(5)9/h2-4H,9H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1325 |
| Density: | 98 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.538 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Brown solid. |
| Packinggroup: | III |
| HS Code: | 29214300 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
T:Toxic
Xn:Harmful
|
| |
 |
