| Identification | |
| Name: | 4-methylcatechol |
| Synonyms: | 4-Methyl-1,2-dihydroxybenzene; 2-Hydroxy-4-methylphenol; 4-Methyl-1,2-benzenediol (4-methylpyrocatechol); 4-methyl-2-benzenediol; 4-methyl-benzene-1,2-diol; 4-methyl-pyrocatecho; p-methylcatechol; p-Methylpyrocatechol |
| CAS: | 452-86-8 |
| EINECS: | 207-214-5 |
| Molecular Formula: | C7H8O2 |
| Molecular Weight: | 124.14 |
| InChI: | InChI=1/C7H8O2/c1-5-2-3-6(8)7(9)4-5/h2-4,8-9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.129 |
| Refractive index: | 1.594 |
| Water Solubility: | soluble |
| Solubility: | soluble in water |
| Appearance: | off-white to red crystalline powder |
| Specification: | white to brown powder or chunks Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
