Identification |
Name: | p-Fluoroanisole |
Synonyms: | 4-Fluoroanisole; 1-Fluoro-4-methoxybenzene |
CAS: | 459-60-9 |
EINECS: | 207-295-7 |
Molecular Formula: | C7H7FO |
Molecular Weight: | 126.13 |
InChI: | InChI=1/C7H7FO/c1-9-7-4-2-6(8)3-5-7/h2-5H,1H3 |
Molecular Structure: |
|
Properties |
Transport: | UN 3271 |
Density: | 1.114 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.4867-1.4887 |
Solubility: | Insoluble |
Appearance: | Colorless to light yellow liquid |
Packinggroup: | III |
Storage Temperature: | Flammables area |
Usage: | An Acetanilide and Anisole derivative metabolite by liver. |
Safety Data |
Hazard Symbols |
F: Flammable
|
|
|