| Identification | |
| Name: | m-Fluoroanisole |
| Synonyms: | 3-Fluoroanisole |
| CAS: | 456-49-5 |
| EINECS: | 207-267-4 |
| Molecular Formula: | C7H7FO |
| Molecular Weight: | 126.13 |
| InChI: | InChI=1/C7H7FO/c1-9-7-4-2-3-6(8)5-7/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1992 |
| Melting Point: | 0oC |
| Density: | 1.104 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4876-1.4896 |
| Solubility: | Insoluble |
| Appearance: | Yellowish liquid. |
| Specification: | clear colorless to straw yellow liquid Safety Statements:16 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | III |
| HS Code: | 29093090 |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
F: Flammable
|
 |
|
