| Identification | |
| Name: | Benzene,2-(chloromethyl)-1,4-difluoro- |
| Synonyms: | Toluene, a-chloro-2,5-difluoro-(6CI,7CI,8CI); 2,5-Difluorobenzyl chloride;2-(Chloromethyl)-1,4-difluorobenzene |
| CAS: | 495-07-8 |
| Molecular Formula: | C7H5 Cl F2 |
| Molecular Weight: | 162.56 |
| InChI: | InChI=1/C7H5ClF2/c8-4-5-3-6(9)1-2-7(5)10/h1-3H,4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN1760 |
| Flash Point: | 61.3°C |
| Boiling Point: | 173.5°Cat760mmHg |
| Density: | 1.294g/cm3 |
| Refractive index: | 1.485 |
| Specification: | Clear colorless liquid Safety Statements:45-36/37/39-26 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Packinggroup: | III |
| Flash Point: | 61.3°C |
| Sensitive: | Lachrymatory |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
Xi: Irritant
|
 |
|
