| Identification |
| Name: | 10H-Phenothiazine-10-propanamine,2-chloro-N,N-dimethyl- |
| Synonyms: | Phenothiazine,2-chloro-10-[3-(dimethylamino)propyl]- (7CI,8CI);2-Chloro-10-[3-(dimethylamino)propyl]phenothiazine; 2-Chloropromazine; 2601A;Aminazin; Aminazine; Ampliactil; Amplictil; BC 135; CPZ; Chlor-Promanyl;Chlordelazin; Chlorderazin; Chlorpromados; Chlorpromazine; Chlropromados;Contomin; Elmarin; Esmind; Fenactil; Fenaktyl; Fraction AB; HL 5746;Largactilothiazine; Largactyl; Megaphen; NSC 167745; NSC 226514; Noiafren;Novomazina; Phenactyl; Proma; Promactil; Promazil; Propaphenin; Prozil; RP4560; SKF 2601A; Sanopron; Sedatil; Thorazin; Thorazine; Wintermin |
| CAS: | 50-53-3 |
| EINECS: | 200-045-8 |
| Molecular Formula: | C17H19 Cl N2 S |
| Molecular Weight: | 318.86 |
| InChI: | InChI=1/C17H19ClN2S/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)21-17-9-8-13(18)12-15(17)20/h3-4,6-9,12H,5,10-11H2,1-2H3 |
| Molecular Structure: |
![(C17H19ClN2S) Phenothiazine,2-chloro-10-[3-(dimethylamino)propyl]- (7CI,8CI);2-Chloro-10-[3-(dimethylamino)propyl]...](https://img.guidechem.com/casimg/50-53-3.gif) |
| Properties |
| Transport: | 25kgs |
| Melting Point: | 192 - 196 C (decomposes) |
| Flash Point: | 226°C |
| Boiling Point: | 450.1°Cat760mmHg |
| Density: | 1.212g/cm3 |
| Water Solubility: | Soluble |
| Solubility: | Soluble Appearance:white to off-white crystalline powder Transport Information:25kgs Hazard Symbols:6.1 (Packing Group: III) UN NO.
|
| Appearance: | white to off-white crystalline powder |
| Specification: |
IUPAC: 3-(2-chlorophenothiazin-10-yl)-N,N-dimethylpropan-1-amine(50-53-3)
CAS: 50-53-3
Synonyms: 10H-Phenothiazine-10-propanamine, 2-chloro-N,N-dimethyl-;2601-A;2-Chloro-10-[3-(dimethyamino)propyl]phenothiazine;2-Chloropromazine;2-Cloro-10 (3-dimetilaminopropil)fenotiazina;3-(2-Chloro-10H-phenothiazin-10-yl)-N,N-dimethyl-1-propanamine;4560 R.P.;Aminasine
|
| Flash Point: | 226°C |
| Color: | Oily liquid White, crystalline solid |
| Safety Data |
| Hazard Symbols |
6.1 (Packing Group: III) UN NO.
|
| |
 |