| Identification | |
| Name: | 10H-Phenothiazine-10-propanamine,2-chloro-N,N-dimethyl-, hydrochloride (1:1) |
| Synonyms: | 10H-Phenothiazine-10-propanamine,2-chloro-N,N-dimethyl-, monohydrochloride (9CI);Phenothiazine,2-chloro-10-[3-(dimethylamino)propyl]-, monohydrochloride (8CI);2-Chloro-10-(3-dimethylaminopropyl)phenothiazine monohydrochloride;Aminazin monohydrochloride;Chloractil;Hebanil;Hibanil;Hibernal;Klorproman;Klorpromex;Largactil;Largaktyl;Marazine;Megatil;Norcozine;Promacid;Propaphen; |
| CAS: | 69-09-0 |
| EINECS: | 200-701-3 |
| Molecular Formula: | C17H19ClN2S.HCl |
| Molecular Weight: | 355.32 |
| InChI: | InChI=1/C17H19ClN2S.ClH/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)21-17-9-8-13(18)12-15(17)20;/h3-4,6-9,12H,5,10-11H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 1 |
| Density: | 1.077 g/cm3 (15 C) |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. Air and light sesnsitive. |
| Refractive index: | 1.4436 (20 C) |
| Solubility: | >=10 g/100 mL at 24 oC |
| Appearance: | creamy white crystalline powder |
| Packinggroup: | III |
| HS Code: | 29173980 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Oily liquid White, crystalline solid |
| Usage: | Used as an Antiemetic, Antipsychotic |
| Safety Data | |
 |
|
