| Identification | |
| Name: | D-Glucitol |
| Synonyms: | Sorbitol syrup C;Sorbitur;Sorbogem 712;Sorbostyl;Sorbitol Powder;Sorbitol (7CI);(-)-Sorbitol;C*Sorbidex;C*Sorbidex P 16616;CSorbidex 16100;Cholaxine;Cystosol;D-Sorbit 50M;Glucarine;Glucitol;Karion;Karioninstant;L-Gulitol;Multitol;NSC 25944;Neosorb;Neosorb 20/60DC;Neosorb 70/02SB;Neosorb 70/70;Neosorb P 60;Nivitin;Resulax;Sionit K;Sionite;Siosan;Sorbex R;Sorbex Rp;Sorbex S;Sorbidex S 16601;Sorbit LTSP;Sorbit T 70;Sorbit W-Powder;Sorbit WP;Sorbitol F;Sorbitol FP;Sorbitol S; |
| CAS: | 50-70-4 |
| EINECS: | 200-061-5 |
| Molecular Formula: | C6H14O6 |
| Molecular Weight: | 182.17 |
| InChI: | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5-,6-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 250kgs |
| Melting Point: | 93 to 98 C |
| Boiling Point: | 295 C |
| Density: | 1.489g/cm3 |
| Stability: | Stable. Avoid strong oxidizing agents. Protect from moisture. |
| Alpha: | 4 o (PER EUR. PHARM.) |
| Water Solubility: | soluble in water |
| Solubility: | Freely soluble (soluble in acetic acid, methanol and ethanol) insoluble in common organic solvents |
| Appearance: | clear to light yellow syrupy liquid |
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| HS Code: | 29054491 |
| Storage Temperature: | Store at RT. |
| Sensitive: | Hygroscopic |
| Color: | Orthorhombic needles from alc WHITE, CRYSTALLINE POWDER OR FREE FLOWING GRANULES |
| Safety Data | |
 |
|
