| Identification | |
| Name: | Boronicacid, B-[1,1'-biphenyl]-4-yl- |
| Synonyms: | 4-Biphenylboronicacid (6CI,7CI,8CI);Boronic acid, [1,1'-biphenyl]-4-yl- (9CI);(1,1'-Biphenyl)-4-boronic acid;4-(Dihydroxyboryl)-1,1'-biphenyl;4-Phenylbenzeneboronic acid;p-Biphenylboronic acid; |
| CAS: | 5122-94-1 |
| EINECS: | -0 |
| Molecular Formula: | C12H11BO2 |
| Molecular Weight: | 198.03 |
| InChI: | InChI=1/C12H11BO2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,14-15H |
| Molecular Structure: | ![(C12H11BO2) 4-Biphenylboronicacid (6CI,7CI,8CI);Boronic acid, [1,1'-biphenyl]-4-yl- (9CI);(1,1'-Biphenyl)-4-boro...](https://img.guidechem.com/casimg/5122-94-1.gif) |
| Properties | |
| Density: | 1.18 g/cm3 |
| Refractive index: | 1.61 |
| Appearance: | Solid |
| Specification: | Solid usageEng:suzuki reaction Safety Statements:26-37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| HS Code: | 29310095 |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
