| Identification | |
| Name: | N-Iodosuccinimide |
| Synonyms: | 1-IODO-2,5-PYRROLIDINEDIONE ; NIS ; 1-iodo-5-pyrrolidinedione ; n-iodo-succinimid ; Succinimide,N-iodo- ; succiniodimide ; 1-iodopyrrolidine-2,5-dione ; Iodosuccinimide ; 2,5-Pyrrolidinedione, 1-iodo- ; |
| CAS: | 516-12-1 |
| EINECS: | 208-221-6 |
| Molecular Formula: | C4H4INO2 |
| Molecular Weight: | 224.98 |
| InChI: | InChI=1/C4H4INO2/c5-6-3(7)1-2-4(6)8/h1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 2.31 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | decomposes |
| Solubility: | decomposes |
| Appearance: | white to off-white powder |
| Specification: |
N-Iodosuccinimide (CAS NO.516-12-1) is a white-yellow to brown crystalline powder,be sensitive to water and ligh.In organic synthesis for ketones, aldehydes of iodide, primarily as a pharmaceutical intermediates in the biological drug, its production method is without light conditions, in reaction of succinimide and silver oxide, Preparation N-succinic imide silver, in dry dioxane in the reaction ti get N-iodo succinimide. |
| HS Code: | 29251995 |
| Sensitive: | Moisture Sensitive |
| Usage: | Iodination of ketones and aldehydes. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
