| Identification | |
| Name: | Methane, trinitro- |
| Synonyms: | Nitroform(6CI);Nitroform (explosive);Trinitromethane |
| CAS: | 517-25-9 |
| EINECS: | 208-236-8 |
| Molecular Formula: | CH N3 O6 |
| Molecular Weight: | 151.05 |
| InChI: | InChI=1/CHN3O6/c5-2(6)1(3(7)8)4(9)10/h1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 0473 |
| Flash Point: | 73°C |
| Boiling Point: | 175.1°Cat760mmHg |
| Density: | 1.803g/cm3 |
| Refractive index: | 1.501 |
| Specification: |
Trinitromethane (CAS NO.517-25-9) forms a series of bright yellow ionic salts. Many of these salts tend to be unstable and can be easily detonated by heat or impact. Because aqueous solutions of trinitromethane are quite acidic, this poses a handling danger similar to that of picric acid due to corrosion of iron or aluminum surfaces. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 73°C |
| Safety Data | |
 |
|
