| Identification |
| Name: | Benzene,2-bromo-1-methoxy-4-nitro- |
| Synonyms: | Anisole,2-bromo-4-nitro- (7CI,8CI); 1-Bromo-2-methoxy-5-nitrobenzene;2-Bromo-1-methoxy-4-nitrobenzene; 2-Bromo-4-nitroanisole;2-Methoxy-5-nitrobromobenzene; 3-Bromo-4-methoxynitrobenzene;4-Nitro-2-bromoanisole; NSC 143545 |
| CAS: | 5197-28-4 |
| EINECS: | 225-983-5 |
| Molecular Formula: | C7H6 Br N O3 |
| Molecular Weight: | 232.03 |
| InChI: | InChI=1/C7H6BrNO3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 139.1°C |
| Boiling Point: | 306.3°C at 760 mmHg |
| Density: | 1.64g/cm3 |
| Refractive index: | 1.581 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
| Flash Point: | 139.1°C |
| Storage Temperature: | Room temperature. |
| Safety Data |
| |
 |