| Identification | |
| Name: | Butanedioicacid, 2,3-dibromo- |
| Synonyms: | Succinicacid, 2,3-dibromo- (6CI,7CI,8CI); Succinic acid, a,b-dibromo-(3CI); 2,3-Dibromosuccinic acid; NSC 119053; NSC 1904; a,b-Dibromosuccinicacid |
| CAS: | 526-78-3 |
| EINECS: | 208-396-9 |
| Molecular Formula: | C4H4 Br2 O4 |
| Molecular Weight: | 275.88016 |
| InChI: | InChI=1S/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Melting Point: | 270 - 280 C |
| Density: | 2.486g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | Slightly soluble |
| Solubility: | Slightly soluble |
| Appearance: | white crystals |
| Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| HS Code: | 29171990 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Safety Data | |
| Hazard Symbols | |
 |
|
