| Identification | |
| Name: | Gluconic acid |
| Synonyms: | D-Gluconic acid solution; Gluconicacidaqsoln; D-Gluconic acid |
| CAS: | 526-95-4 |
| EINECS: | 208-401-4 |
| Molecular Formula: | C6H12O7 |
| Molecular Weight: | 196.16 |
| InChI: | InChI=1/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3-,4+,5-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3265 |
| Density: | 1.24 (50-52% aq.) |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.4161 |
| Solubility: | Very soluble |
| Appearance: | Clear, yellow to brown liquid - 50% by weight in water. |
| Packinggroup: | III |
| Storage Temperature: | Store at RT. |
| Color: | YELLOWISH-WHITE CRYSTALS |
| Usage: | Component in ccleaning and striping formulations. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
