| Identification | |
| Name: | 4-Hydroxycarbazole |
| Synonyms: | 4-Hydroxy-9H-carbazole; hydroxycarbazole |
| CAS: | 52602-39-8 |
| EINECS: | 258-034-9 |
| Molecular Formula: | C12H9NO |
| Molecular Weight: | 183.21 |
| InChI: | InChI=1/C12H9NO/c14-11-7-3-6-10-12(11)8-4-1-2-5-9(8)13-10/h1-7,13-14H |
| Molecular Structure: |  |
| Properties | |
| Transport: | GEN |
| Density: | 1.362 g/cm3 |
| Refractive index: | 1.815?????? |
| Appearance: | brown powder |
| Specification: | Light-Yellow Solid Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
