| Identification |
| Name: | Benzenamine,2-methyl-6-(1-methylethyl)- |
| Synonyms: | m-Cymen-2-amine(6CI,8CI);2-Isopropyl-6-methylaniline;2-Isopropyl-6-methylphenylamine;6-Isopropyl-o-toluidine; |
| CAS: | 5266-85-3 |
| EINECS: | 226-083-5 |
| Molecular Formula: | C10H15N |
| Molecular Weight: | 149.23 |
| InChI: | InChI=1/C10H15N/c1-7(2)9-6-4-5-8(3)10(9)11/h4-7H,11H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 1993 |
| Density: | 0.94 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | n20/D 1.544(lit.) |
| Solubility: | Insoluble |
| Appearance: | Dark red to brown liquid. |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. Keep containers tightly closed. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
