| Identification | |
| Name: | Benzenamine,2-(1-methylethyl)- |
| Synonyms: | Aniline,o-isopropyl- (6CI,7CI,8CI); (2-Isopropylphenyl)amine;1-Amino-2-isopropylbenzene; 2-(1-Methylethyl)aniline; 2-(1-Methylethyl)benzenamine;2-Aminoisopropylbenzene; 2-Isopropylaniline; 2-Isopropylbenzenamine;[2-(1-Methylethyl)phenyl]amine; o-Aminocumene; o-Aminoisopropylbenzene;o-Cumidine; o-Isopropylaniline |
| CAS: | 643-28-7 |
| EINECS: | 211-397-7 |
| Molecular Formula: | C9H13 N |
| Molecular Weight: | 135.20 |
| InChI: | InChI=1/C9H13N/c1-7(2)8-5-3-4-6-9(8)10/h3-7H,10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.966 |
| Refractive index: | n20/D 1.548(lit.) |
| Specification: |
Avoid breathing dust, vapor, mist, or gas. Avoid contact with skin and eyes. Avoid ingestion and inhalation.Keep away from sources of ignition. Store in a cool, dry place. Do not store in direct sunlight. Store in a tightly closed container. |
| Report: |
Reported in EPA TSCA Inventory. |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
