| Identification |
| Name: | 2,3-dibromopropyl prop-2-enoate; methyl 2-methylprop-2-enoate; 2-methylprop-2-enoic acid |
| Synonyms: | AC1O55XG;2,3-Dibromopropyl acrylate, methyl methacrylate, methacrylic acid polymer;2,3-dibromopropyl prop-2-enoate; methyl 2-methylprop-2-enoate; 2-methylprop-2-enoic acid;2-Propenoic acid, 2-methyl-, polymer with 2,3-dibromopropyl 2-propenoate and methyl 2-methyl-2-propenoate;52664-82-1 |
| CAS: | 52664-82-1 |
| Molecular Formula: | C15H22Br2O6 |
| Molecular Weight: | 458.1396 |
| InChI: | InChI=1/C6H8Br2O2.C5H8O2.C4H6O2/c1-2-6(9)10-4-5(8)3-7;1-4(2)5(6)7-3;1-3(2)4(5)6/h2,5H,1,3-4H2;1H2,2-3H3;1H2,2H3,(H,5,6) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 121.1°C |
| Boiling Point: | 276.7°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 121.1°C |
| Safety Data |
| |
 |
