| Identification |
| Name: | butyl prop-2-enoate; 2-methylenebutanoate; methyl 2-methylprop-2-enoate; 2-methylprop-2-enoic acid |
| Synonyms: | 2-Propenoic acid, 2-methyl-, polymer with butyl 2-propenoate, ethyl 2-propenoate and methyl 2-methyl-2-propenoate;25035-88-5;butyl prop-2-enoate; 2-methylenebutanoate; methyl 2-methylprop-2-enoate; 2-methylprop-2-enoic acid;AC1Q5YJ0;AC1L51H6;AR-1I1329;Methacrylic acid, ethyl acrylate, butyl acrylate, methyl methacrylate polymer;Ethyl acrylate, methacrylic acid, butyl acrylate, methyl methacrylate polymer;877170-25-7;butyl prop-2-enoate; 2-methylidenebutanoate; methyl 2-methylprop-2-enoate; 2-methylprop-2-enoic acid |
| CAS: | 25035-88-5;263744-76-9 |
| Molecular Formula: | C21H33O8 |
| Molecular Weight: | 413.4825 |
| InChI: | InChI=1/C7H12O2.2C5H8O2.C4H6O2/c1-3-5-6-9-7(8)4-2;1-4(2)5(6)7-3;1-3-4(2)5(6)7;1-3(2)4(5)6/h4H,2-3,5-6H2,1H3;1H2,2-3H3;2-3H2,1H3,(H,6,7);1H2,2H3,(H,5,6)/p-1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 39.4°C |
| Boiling Point: | 145.9°C at 760 mmHg |
| Flash Point: | 39.4°C |
| Safety Data |
| |
 |
