| Identification | |
| Name: | Benzaldehyde, 2-methyl- |
| Synonyms: | o-Tolualdehyde(8CI);2-Formyltoluene;2-Tolualdehyde;NSC 103152;o-Methylbenzaldehyde;o-Toluic aldehyde;o-Tolylaldehyde; |
| CAS: | 529-20-4 |
| EINECS: | 208-452-2 |
| Molecular Formula: | C8H8O |
| Molecular Weight: | 120.15 |
| InChI: | InChI=1/C8H8O/c1-7-4-2-3-5-8(7)6-9/h2-6H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.039 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.546-1.458 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | Clear liquid. |
| Specification: | clear colorless to yellow liquid Safety Statements:26-39-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 39:Wear eye/face protection 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| HS Code: | 29122900 |
| Storage Temperature: | Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Color: | Liquid |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
