| Identification | |
| Name: | 6-Cyano-2-naphthol |
| Synonyms: | 2-Cyano-6-hydroxynaphthalene;2-Hydroxy-6-naphthonitrile;6-Cyano-2-hydroxynaphthalene;6-Hydroxy-2-naphthalenecarbonitrile; |
| CAS: | 52927-22-7 |
| Molecular Formula: | C11H7NO |
| Molecular Weight: | 169.18 |
| InChI: | InChI=1/C11H7NO/c12-7-8-1-2-10-6-11(13)4-3-9(10)5-8/h1-6,13H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 185.5 ºC |
| Density: | 1.28 g/cm3 |
| Refractive index: | 1.692 |
| Appearance: | Brown Crystalline Solid |
| Specification: |
6-Cyano-2-Naphthol , with CAS number of 52927-22-7, can be called 6-Hydroxy-2-naphthalenecarbonitrile ; 2-Cyano-6-hydroxynaphthalene ; 2-Hydroxy-6-naphthonitrile . 6-Cyano-2-Naphthol (CAS NO.52927-22-7) is functional Material,and can be used for building blocks forliquid crystals. |
| Flash Point: | 185.5 ºC |
| Storage Temperature: | -20?C Freezer |
| Usage: | Intermediate of Nafamostat mesilate (N210000). |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
