| Identification | |
| Name: | 3-Amino-2-naphthol |
| Synonyms: | 2-Hydroxy-3-aminonaphthalene |
| CAS: | 5417-63-0 |
| EINECS: | 226-519-4 |
| Molecular Formula: | C10H9NO |
| Molecular Weight: | 159.1846 |
| InChI: | InChI=1S/C10H9NO/c11-9-5-7-3-1-2-4-8(7)6-10(9)12/h1-6,12H,11H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.281 g/cm3 |
| Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Safety Data | |
 |
|
