| Identification |
| Name: | Benzoicacid, 2-amino-5-iodo- |
| Synonyms: | Anthranilicacid, 5-iodo- (6CI,8CI);5-Iodo-2-aminobenzoicacid;5-Iodoanthranilic acid;NSC 302;2-Amino-5-iodo-benzoic acid; |
| CAS: | 5326-47-6 |
| EINECS: | 226-205-7 |
| Molecular Formula: | C7H6INO2 |
| Molecular Weight: | 263.03 |
| InChI: | InChI=1/C7H6INO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,9H2,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Density: | 2.082g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Insoluble |
| Appearance: | white to light yellow crystal powder |
| HS Code: | 29224995 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
