| Identification | |
| Name: | Benzoicacid, 5-amino-2-chloro- |
| Synonyms: | 2-Chloro-5-aminobenzoicacid;3-Amino-6-chlorobenzoic acid;NSC 25172;2-Chloro-5-Aminobenzoic Acid; |
| CAS: | 89-54-3 |
| EINECS: | 201-916-5 |
| Molecular Formula: | C7H6ClNO2 |
| Molecular Weight: | 171.59 |
| InChI: | InChI=1/C7H6ClNO2/c8-6-2-1-4(9)3-5(6)7(10)11/h1-3H,9H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.476 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.648 |
| Solubility: | Very soluble |
| Appearance: | White-similar crystalline powder |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
