| Identification | |
| Name: | 4H-1,3,2-Benzodioxaphosphorin-4-one,2-chloro-, 2-oxide |
| Synonyms: | Salicylicacid, hydrogen phosphorochloridate, cyclic anhydride (7CI,8CI); Salicylic acid,phosphorochloridate, cyclic anhydride (6CI); Phosphorochloridic acid, monoesterwith salicylic acid, cyclic anhydride; NSC 46474 |
| CAS: | 5381-98-6 |
| Molecular Formula: | C7H4 Cl O4 P |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C7H4ClO4P/c8-13(10)11-6-4-2-1-3-5(6)7(9)12-13/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 208°C |
| Boiling Point: | 326.2°Cat760mmHg |
| Density: | 1.62g/cm3 |
| Refractive index: | 1.575 |
| Specification: | usageEng:A enicillin-Like?inhibitor of ?Lactamases |
| Flash Point: | 208°C |
| Usage: | A enicillin-Like?inhibitor of ?Lactamases |
| Safety Data | |
 |
|
