| Identification |
| Name: | 4H-1,3,2-Benzodioxaphosphorin-4-one,2-chloro- |
| Synonyms: | Salicylicacid, hydrogen phosphorochloridite, cyclic anhydride (7CI,8CI); Salicylic acid,phosphorochloridite, cyclic anhydride (6CI); Phosphorochloridous acid,monoester with salicylic acid, cyclic anhydride (8CI);2-Chloro-4-oxo-5,6-benzo-1,3,2-dioxaphosphorinane;2-Chloro-4H-1,3,2-benzodioxaphoshorin-4-one;2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one; 2-Chloro-4H-benzodioxaphosphorin-4-one;NSC 40209; SCP; Salicyl chlorophosphite; Salicyl phosphorochloridite |
| CAS: | 5381-99-7 |
| Molecular Formula: | C7H4 Cl O3 P |
| Molecular Weight: | 202.53 |
| InChI: | InChI=1/C7H4ClO3P/c8-12-10-6-4-2-1-3-5(6)7(9)11-12/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3261 8/PG 1 |
| Flash Point: | 109.7°C |
| Density: | g/cm3 |
| Stability: | Water Sensitive |
| Specification: |
2-Chloro-4H-1,3,2-benzodioxaphosphinin-4-one , its CAS NO. is 5381-99-7, the synonyms are Van Boom's Reagent ; Salicylchlorophosphite ; NSC40209 ; OR3651T ; CID237010 .
|
| Packinggroup: | II |
| Flash Point: | 109.7°C |
| Storage Temperature: | 2-8°C |
| Usage: | Highly reactive cyclic phosphitylating reagent which provides fast coupling rates, and hydrolytic cleavage occurs more readily than with acyclic analogs |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |