| Identification | |
| Name: | Hexanedioic acid,2-amino- |
| Synonyms: | 2-Aminoadipate;2-Aminoadipic acid;DL-2-Aminoadipic acid;DL-2-Aminohexanedioic acid;NSC 46994; |
| CAS: | 542-32-5 |
| EINECS: | 208-809-2 |
| Molecular Formula: | C6H11NO4 |
| Molecular Weight: | 179.17 |
| InChI: | InChI=1/C6H11NO4/c7-4(6(10)11)2-1-3-5(8)9/h4H,1-3,7H2,(H,8,9)(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 173.9°C |
| Boiling Point: | 364°Cat760mmHg |
| Density: | 1.333g/cm3 |
| Appearance: | crystalline |
| Specification: | Crystalline usageEng:An amino acid isolated from Cholera vibrio Safety Statements:22-24/25-36-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 173.9°C |
| Storage Temperature: | 2-8°C |
| Usage: | An amino acid isolated from Cholera vibrio |
| Safety Data | |
 |
|
