| Identification | |
| Name: | 2-Methyl-5-nitrophenol |
| Synonyms: | 5-Nitro ortho cresol; 5-NITRO-O-CRESOL |
| CAS: | 5428-54-6 |
| EINECS: | 226-580-7 |
| Molecular Formula: | C7H7NO3 |
| Molecular Weight: | 153.14 |
| InChI: | InChI=1/C7H7NO3/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2446 |
| Flash Point: | 180 ºC / 15mmHg |
| Boiling Point: | 180 ºC / 15mmHg |
| Density: | 1.32g/cm3 |
| Refractive index: | 1.578 |
| Specification: | Brown solid Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| HS Code: | 29089000 |
| Flash Point: | 180 ºC / 15mmHg |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
