| Identification |
| Name: | Butane,1,1'-oxybis[3-methyl- |
| Synonyms: | Isopentyl ether(6CI,7CI,8CI);Di-3-methylbutyl ether;Diisoamyl ether;Diisopentyl ether;Isoamyl ether;Isoamyl oxide;NSC 9281; |
| CAS: | 544-01-4 |
| EINECS: | 208-857-4 |
| Molecular Formula: | C10H22O |
| Molecular Weight: | 158.28 |
| InChI: | InChI=1/C10H22O/c1-9(2)5-7-11-8-6-10(3)4/h9-10H,5-8H2,1-4H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3271 |
| Melting Point: | -75 |
| Density: | 0.778 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.407-1.409 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | Colorless transparent liquid |
| Packinggroup: | III |
| HS Code: | 29091900 |
| Storage Temperature: | Flammables area |
| Color: | COLORLESS LIQUID |
| Usage: | Solvent in grignard reaction, also as solvent of odorous principles, manufacture lacquers, regenerating rubber. |
| Safety Data |
| |
 |
