| Identification | |
| Name: | Hydrazine,(1-methyl-2-phenylethyl)- |
| Synonyms: | Hydrazine,(a-methylphenethyl)- (6CI,8CI);(1-Methyl-2-phenylethyl)hydrazine;(a-Methylphenethyl)hydrazine;(b-Phenylisopropyl)hydrazine;1-Phenyl-2-hydrazinopropane;2-Hydrazino-1-phenylpropane;Catron;Dicatron;PIH;Pheniprazine;Phenizine |
| CAS: | 55-52-7 |
| EINECS: | 200-236-6 |
| Molecular Formula: | C9H14 N2 |
| Molecular Weight: | 150.25 |
| InChI: | InChI=1/C9H14N2.ClH/c1-8(11-10)7-9-5-3-2-4-6-9;/h2-6,8,11H,7,10H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 148°C |
| Boiling Point: | 287.1°Cat760mmHg |
| Density: | 0.99g/cm3 |
| Refractive index: | 1.539 |
| Specification: |
Pheniprazine (CAS NO.55-52-7) is an irreversible and nonselective monoamine oxidase inhibitor (MAOI) of the hydrazine chemical class. |
| Flash Point: | 148°C |
| Safety Data | |
 |
|
