| Identification | |
| Name: | 6-Aminopenicillanic acid |
| Synonyms: | 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-amino-3,3-dimethyl-7-oxo-, [2S-(2alpha,5alpha,6beta)]-; 6-Amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid; 6-APA; aminopenicillanic acid; |
| CAS: | 551-16-6 |
| EINECS: | 208-993-4 |
| Molecular Formula: | C8H12N2O3S |
| Molecular Weight: | 216.26 |
| InChI: | InChI=1/C8H12N2O3S/c1-8(2)4(7(12)13)10-5(11)3(9)6(10)14-8/h3-4,6H,9H2,1-2H3,(H,12,13)/t3-,4+,6-/m1/s1 |
| Molecular Structure: | ![(C8H12N2O3S) 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-amino-3,3-dimethyl-7-oxo-, [2S-(2alpha,5alpha...](https://img.guidechem.com/casimg/551-16-6.gif) |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 232.1°C |
| Boiling Point: | 460.2 ºC at 760 mmHg |
| Density: | 1.52g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.656 |
| Alpha: | 276.3 º (C=1.2, 0.1N HCL 22 ºC) |
| Solubility: | Very soluble |
| Appearance: | white to off white free flowing crystalline powder |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29349990 |
| Flash Point: | 232.1°C |
| Storage Temperature: | 2-8°C |
| Usage: | Substance is used in production of synthetic penicillins. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
