| Identification | |
| Name: | 4-Aminobenzaldehyde |
| Synonyms: | p-Aminobenzaldehyde;Benzaldehyde, 4-amino-;Benzaldehyde, p-amino-;4-Formylaniline;Benzaldehyde, p-amino- (8CI);p-Formylaniline; |
| CAS: | 556-18-3 |
| EINECS: | 209-115-2 |
| Molecular Formula: | C7H7NO |
| Molecular Weight: | 121.13658 |
| InChI: | InChI=1S/C7H7NO/c8-7-3-1-6(5-9)2-4-7/h1-5H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1307 |
| Density: | 1.171 g/cm3 |
| Water Solubility: | Soluble alcohol, ether and benzene, almost insoluble in water, |
| Solubility: | Soluble alcohol, ether and benzene, almost insoluble in water, |
| Appearance: | Yellow crystalline |
| Specification: | Safety Statements:26-36/37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Packinggroup: | Z01 |
| Safety Data | |
 |
|
