| Identification | |
| Name: | 2-Mercapto-5-methoxybenzothiazole |
| Synonyms: | 5-Methoxybenzothiazole-2-thiol |
| CAS: | 55690-60-3 |
| EINECS: | 259-755-1 |
| Molecular Formula: | C8H7NOS2 |
| Molecular Weight: | 197.26 |
| InChI: | InChI=1/C8H7NOS2/c1-10-5-2-3-7-6(4-5)9-8(11)12-7/h2-4H,1H3,(H,9,11) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 190-193°C |
| Flash Point: | 159.9°C |
| Boiling Point: | 340.8°C at 760 mmHg |
| Density: | 1.44g/cm3 |
| Refractive index: | 1.728 |
| Specification: | Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Flash Point: | 159.9°C |
| Safety Data | |
 |
|
