| Identification | |
| Name: | 2-Amino-6-methoxybenzothiazole |
| Synonyms: | 6-methoxybenzothiazol-2-ylamine |
| CAS: | 1747-60-0 |
| EINECS: | 217-130-0 |
| Molecular Formula: | C8H8N2OS |
| Molecular Weight: | 180.22 |
| InChI: | InChI=1/C8H8N2OS/c1-11-5-2-3-6-7(4-5)12-8(9)10-6/h2-4H,1H3,(H2,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 163.9oC |
| Density: | 1.359 g/cm3 |
| Stability: | Stable, but may be light sensitive. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.599 |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION |
| Appearance: | Light tan powder |
| Specification: | off-white to tan-coloured powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29342080 |
| Flash Point: | 163.9oC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
