| Identification | |
| Name: | Tryptophan, 5-hydroxy- |
| Synonyms: | DL-5-HTP;DL-5-Hydroxytryptophan;DL-Hydroxytryptophan;NSC 92523; |
| CAS: | 56-69-9 |
| EINECS: | 200-284-8 |
| Molecular Formula: | C11H12N2O3 |
| Molecular Weight: | 220.25 |
| InChI: | InChI=1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 1.484 |
| Stability: | No data. |
| Solubility: | Very soluble |
| Appearance: | White Solid |
| Specification: | Off-White to Pale Beige Solid usageEng:A metabolite of Tryptophan Safety Statements:24/25-22 24/25:Avoid contact with skin and eyes 22:Do not breathe dust |
| Packinggroup: | III |
| Color: | Minute rods or needles from ethanol |
| Usage: | Medication. |
| Safety Data | |
 |
|
