| Identification | |
| Name: | Phosphorodiamidouschloride, N,N,N',N'-tetrakis(1-methylethyl)- |
| Synonyms: | Phosphorodiamidouschloride, tetrakis(1-methylethyl)- (9CI);Bis(diisopropylamino)chlorophosphine;Chlorobis(N,N-diisopropyl)phosphoramidite;Chlorobis(N,N-diisopropylamino)phosphine;Chlorobis(diisopropylamino)phosphine;Tetraisopropylphosphorodiamidous chloride; |
| CAS: | 56183-63-2 |
| Molecular Formula: | C12H28ClN2P |
| Molecular Weight: | 266.79 |
| InChI: | InChI=1/C12H28ClN2P/c1-9(2)14(10(3)4)16(13)15(11(5)6)12(7)8/h9-12H,1-8H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8/PG 1 |
| Melting Point: | 100-104 °C(lit.) |
| Specification: | white to light yellow crystal powde Safety Statements:26-27-28-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| Safety Data | |
 |
|
