| Identification | |
| Name: | Phosphorodiamidouschloride, N,N,N',N'-tetraethyl- |
| Synonyms: | Phosphorodiamidouschloride, tetraethyl- (6CI,7CI,8CI,9CI);Bis(N,N-diethylamino)chlorophosphine;Bis(diethylamino)chlorophosphane;Bis(diethylamino)chlorophosphine;Chlorobis(diethylamino)phosphine;N,N,N',N'-Tetraethylphosphorodiamidouschloride;Tetraethyldiamidophosphorous chloride;Tetraethyldiaminochlorophosphite;Tetraethylphosphorodiamidous chloride; |
| CAS: | 685-83-6 |
| Molecular Formula: | C8H20ClN2P |
| Molecular Weight: | 210.684561 |
| InChI: | InChI=1S/C8H20ClN2P/c1-5-10(6-2)12(9)11(7-3)8-4/h5-8H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 1.002 |
| Refractive index: | 1.4895 |
| Water Solubility: | reacts with water |
| Solubility: | reacts with water |
| Appearance: | Colorless to light yellow liqui |
| Specification: | Colorless to light yellow liqui Safety Statements:23-26-36-36/37/39-45 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| Sensitive: | Air & Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
