| Identification | |
| Name: | Semicarbazide hydrochloride |
| Synonyms: | amidourea hydrochloride; Aminourea hydrochloride; Carbamylhydrazine Hydrochloride; Hydrazinecarboxamide, monohydrochloride; Semicarbazide monohydrochloride; Semicarbaxide hydrochloride; Semicarbazide HCL |
| CAS: | 563-41-7 |
| EINECS: | 209-247-0 |
| Molecular Formula: | CH5N3O?HCl |
| Molecular Weight: | 111.53 |
| InChI: | InChI=1/CH5N3O.ClH/c2-1(5)4-3;/h3H2,(H3,2,4,5);1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Boiling Point: | Decomposes |
| Density: | 1.286g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Appearance: | white crystals |
| Packinggroup: | III |
| Color: | Prisms from dilute alcohol White crystals |
| Usage: | Inhibitor of enzyme. Hypotensive |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
