| Identification | |
| Name: | 4H-1-Benzopyran-4-one,3-phenyl- |
| Synonyms: | Isoflavone(6CI,7CI,8CI);3-Phenyl-4-chromone;3-Phenylchromone;Isoflavone 80;NSC 135405; |
| CAS: | 574-12-9 |
| Molecular Formula: | C15H10O2 |
| Molecular Weight: | 222.24 |
| InChI: | InChI=1/C15H10O2/c16-15-12-8-4-5-9-14(12)17-10-13(15)11-6-2-1-3-7-11/h1-10H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 150 |
| Density: | 1.239 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.635 |
| Solubility: | Insoluble |
| Specification: |
? 4H-1-Benzopyran-4-one,3-phenyl- , its cas register number is 574-12-9. It also can be called?Isoflavone?; NSC 135405?; |
| Packinggroup: | II; III |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Food supplement. |
| Safety Data | |
 |
|
