| Identification | |
| Name: | D-Glucaric acid,calcium salt, hydrate (1:1:4) |
| Synonyms: | D-Glucaricacid, calcium salt (1:1), tetrahydrate (9CI);Glucaric acid, calcium salt,tetrahydrate, D- (8CI);Calcium D-saccharate tetrahydrate; |
| CAS: | 5793-89-5 |
| EINECS: | 227-334-1 |
| Molecular Formula: | C6H8CaO8.4H2O |
| Molecular Weight: | 320.26204 |
| InChI: | InChI=1S/C6H10O8.Ca.4H2O/c7-1(3(9)5(11)12)2(8)4(10)6(13)14;;;;;/h1-4,7-10H,(H,11,12)(H,13,14);;4*1H2/q;+2;;;;/p-2/t1-,2-,3-,4+;;;;;/m0...../s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 431.2 ºC |
| Boiling Point: | 766.4 ºC at 760 mmHg |
| Density: | g/cm3 |
| Alpha: | 20.5 º (C=6% IN 5 M HCL) |
| Water Solubility: | Insoluble in cold water, hot water, diethyl ether. Practically insoluble in alcohol.Soluble in dilute mineral acids, and in calcium gluconate solutions. |
| Solubility: | Insoluble in cold water, hot water, diethyl ether. Practically insoluble in alcohol.Soluble in dilute mineral acids, and in calcium gluconate solutions. |
| Appearance: | White Solid |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 431.2 ºC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
