| Identification |
| Name: | diethyl hydrogen phosphate, compound with triethylamine (1:1) |
| Synonyms: | Phosphoric acid, diethyl ester, compd. with N,N-diethylethanamine (1:1);Phosphoric acid, diethyl ester, triethylamine salt;Diethyl hydrogen phosphate, compound with triethylamine (1:1);diethyl hydrogen phosphate - N,N-diethylethanamine (1:1) |
| CAS: | 5802-76-6 |
| EINECS: | 227-354-0 |
| Molecular Formula: | C10H26NO4P |
| Molecular Weight: | 255.2915 |
| InChI: | InChI=1/C6H15N.C4H11O4P/c1-4-7(5-2)6-3;1-3-7-9(5,6)8-4-2/h4-6H2,1-3H3;3-4H2,1-2H3,(H,5,6) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 74.9°C |
| Boiling Point: | 200.3°C at 760 mmHg |
| Density: | g/cm3 |
| HS Code: | 2922199090 |
| Flash Point: | 74.9°C |
| Safety Data |
| |
 |
