| Identification | |
| Name: | trifluoromethanesulphonic acid, compound with triethylamine (1:1) |
| Synonyms: | Methanesulfonic acid, 1,1,1-trifluoro-, ompd. with N,N-diethylethanamine (1:1);Triethylamine salt of trifluoromethanesulfonic acid;Methanesulfonic acid, trifluoro-, compd. with N,N-diethylethanamine (1:1);Trifluoromethanesulphonic acid, compound with triethylamine (1:1);trifluoromethanesulfonic acid - N,N-diethylethanamine (1:1) |
| CAS: | 646-58-2 |
| EINECS: | 211-475-0 |
| Molecular Formula: | C7H16F3NO3S |
| Molecular Weight: | 251.267 |
| InChI: | InChI=1/C6H15N.CHF3O3S/c1-4-7(5-2)6-3;2-1(3,4)8(5,6)7/h4-6H2,1-3H3;(H,5,6,7) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 109.5°C |
| Boiling Point: | 162°C at 760 mmHg |
| Flash Point: | 109.5°C |
| Safety Data | |
 |
|
